Products 50534-25-3

CAS 50534-25-3 is the registry number for N,N-Diethylpiperidin-4-amine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

N,N-diethylpiperidin-4-amine;dihydrochloride (CAS 50534-25-3) is a chemical compound with the molecular formula C9H22Cl2N2 and a molecular weight of 229.19 g/mol. IUPAC name: N,N-diethylpiperidin-4-amine;dihydrochloride. InChIKey: JJGBVMJOHGBPJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H22Cl2N2
Molecular weight229.19 g/mol
IUPAC nameN,N-diethylpiperidin-4-amine;dihydrochloride
InChIKeyJJGBVMJOHGBPJJ-UHFFFAOYSA-N
SMILESCCN(CC)C1CCNCC1.Cl.Cl

Computed by PubChem (NCBI)