CAS 1609406-43-0 appears in our catalog under these names: 6-(Aminomethyl)-2-methyl-4-pyrimidinol dihydrochloride, 95%, 6-(Aminomethyl)-2-methyl-4-pyrimidinol dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4-(aminomethyl)-2-methyl-1H-pyrimidin-6-one;dihydrochloride (CAS 1609406-43-0) is a chemical compound with the molecular formula C6H11Cl2N3O and a molecular weight of 212.07 g/mol. IUPAC name: 4-(aminomethyl)-2-methyl-1H-pyrimidin-6-one;dihydrochloride. InChIKey: XOXDUDKHEFRJGZ-UHFFFAOYSA-N.
| Molecular formula | C6H11Cl2N3O |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 4-(aminomethyl)-2-methyl-1H-pyrimidin-6-one;dihydrochloride |
| InChIKey | XOXDUDKHEFRJGZ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=O)N1)CN.Cl.Cl |
Computed by PubChem (NCBI)