Products 2059948-31-9
CAS 2059948-31-9 appears in our catalog under these names: 5-(2-Aminoethyl)pyrimidin-2-ol dihydrochloride, 95%, 5-(2-Aminoethyl)pyrimidin-2-ol Dihydrochloride, >95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 50mg, 100mg, 250mg.
5-(2-aminoethyl)-1H-pyrimidin-2-one;dihydrochloride (CAS 2059948-31-9) is a chemical compound with the molecular formula C6H11Cl2N3O and a molecular weight of 212.07 g/mol. IUPAC name: 5-(2-aminoethyl)-1H-pyrimidin-2-one;dihydrochloride. InChIKey: CJZNEYMHEKUAHI-UHFFFAOYSA-N.
| Molecular formula | C6H11Cl2N3O |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 5-(2-aminoethyl)-1H-pyrimidin-2-one;dihydrochloride |
| InChIKey | CJZNEYMHEKUAHI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=O)N1)CCN.Cl.Cl |
Computed by PubChem (NCBI)