Products 1609407-84-2
CAS 1609407-84-2 appears in our catalog under these names: 4-Amino-3,4-dihydro-2(1h)-quinolinone hydrochloride, 95%, 4-Amino-3,4-dihydroquinolin-2(1H)-one hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
4-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride (CAS 1609407-84-2) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 4-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride. InChIKey: CRGYPPDNNUECPT-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 4-amino-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
| InChIKey | CRGYPPDNNUECPT-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2NC1=O)N.Cl |
Computed by PubChem (NCBI)