Products 1609671-85-3
CAS 1609671-85-3 is the registry number for 1,1-Dimethylethyl 3-hydroxy-3-[3-(trifluoromethoxy)phenyl]-1-azetidinecarboxy..., 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-hydroxy-3-[3-(trifluoromethoxy)phenyl]azetidine-1-carboxylate (CAS 1609671-85-3) is a chemical compound with the molecular formula C15H18F3NO4 and a molecular weight of 333.30 g/mol. IUPAC name: tert-butyl 3-hydroxy-3-[3-(trifluoromethoxy)phenyl]azetidine-1-carboxylate. InChIKey: HTWPVWKXYFDDFT-UHFFFAOYSA-N.
| Molecular formula | C15H18F3NO4 |
|---|---|
| Molecular weight | 333.30 g/mol |
| IUPAC name | tert-butyl 3-hydroxy-3-[3-(trifluoromethoxy)phenyl]azetidine-1-carboxylate |
| InChIKey | HTWPVWKXYFDDFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C2=CC(=CC=C2)OC(F)(F)F)O |
Computed by PubChem (NCBI)