CAS 1609936-05-1 is the registry number for N-((2,6-Difluorophenyl)methylidene)hydroxylamine. Offered by: Biosynth. Available pack sizes: 2,5g.
(NE)-N-[(2,6-difluorophenyl)methylidene]hydroxylamine (CAS 1609936-05-1) is a chemical compound with the molecular formula C7H5F2NO and a molecular weight of 157.12 g/mol. IUPAC name: (NE)-N-[(2,6-difluorophenyl)methylidene]hydroxylamine. InChIKey: PGWOZJHFLGQGDU-ONNFQVAWSA-N.
| Molecular formula | C7H5F2NO |
|---|---|
| Molecular weight | 157.12 g/mol |
| IUPAC name | (NE)-N-[(2,6-difluorophenyl)methylidene]hydroxylamine |
| InChIKey | PGWOZJHFLGQGDU-ONNFQVAWSA-N |
| SMILES | C1=CC(=C(C(=C1)F)/C=N/O)F |
Computed by PubChem (NCBI)