CAS 19064-16-5 is the registry number for 2,6-Difluorobenzaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg.
(NE)-N-[(2,6-difluorophenyl)methylidene]hydroxylamine (CAS 19064-16-5) is a chemical compound with the molecular formula C7H5F2NO and a molecular weight of 157.12 g/mol. IUPAC name: (NE)-N-[(2,6-difluorophenyl)methylidene]hydroxylamine. InChIKey: PGWOZJHFLGQGDU-ONNFQVAWSA-N.
| Molecular formula | C7H5F2NO |
|---|---|
| Molecular weight | 157.12 g/mol |
| IUPAC name | (NE)-N-[(2,6-difluorophenyl)methylidene]hydroxylamine |
| InChIKey | PGWOZJHFLGQGDU-ONNFQVAWSA-N |
| SMILES | C1=CC(=C(C(=C1)F)/C=N/O)F |
Computed by PubChem (NCBI)