CAS 1609959-45-6 is the registry number for N-((1S)-2-Hydroxy-3-methyl-1-(2-methylpropyl)-3-buten-1-yl)-carbamic Acid 1,1-Dimethylethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
Tert-butyl N-[(4S)-3-hydroxy-2,6-dimethylhept-1-en-4-yl]carbamate (CAS 1609959-45-6) is a chemical compound with the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. IUPAC name: tert-butyl N-[(4S)-3-hydroxy-2,6-dimethylhept-1-en-4-yl]carbamate. InChIKey: RZYBVTBIWWSVJN-PXYINDEMSA-N.
| Molecular formula | C14H27NO3 |
|---|---|
| Molecular weight | 257.37 g/mol |
| IUPAC name | tert-butyl N-[(4S)-3-hydroxy-2,6-dimethylhept-1-en-4-yl]carbamate |
| InChIKey | RZYBVTBIWWSVJN-PXYINDEMSA-N |
| SMILES | CC(C)C[C@@H](C(C(=C)C)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)