Products 2756847-61-5
CAS 2756847-61-5 is the registry number for rel-tert-Butyl (2R,6S)-4-(2-hydroxyethyl)-2,6-dimethylpiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,6S)-4-(2-hydroxyethyl)-2,6-dimethylpiperidine-1-carboxylate (CAS 2756847-61-5) is a chemical compound with the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. IUPAC name: tert-butyl (2R,6S)-4-(2-hydroxyethyl)-2,6-dimethylpiperidine-1-carboxylate. InChIKey: LUEVETSRSVHREW-FOSCPWQOSA-N.
| Molecular formula | C14H27NO3 |
|---|---|
| Molecular weight | 257.37 g/mol |
| IUPAC name | tert-butyl (2R,6S)-4-(2-hydroxyethyl)-2,6-dimethylpiperidine-1-carboxylate |
| InChIKey | LUEVETSRSVHREW-FOSCPWQOSA-N |
| SMILES | C[C@@H]1CC(C[C@@H](N1C(=O)OC(C)(C)C)C)CCO |
Computed by PubChem (NCBI)