CAS 1609964-38-6 appears in our catalog under these names: tert-Butyl 1-imino-1-oxo-1(lambda6)-thiomorpholine-4-carboxylate, 95%, tert-Butyl 1-iminothiomorpholine-4-carboxylate 1-oxide 95%, tert-Butyl 1-iminothiomorpholine-4-carboxylate 1-oxide, 95%, 95%, tert-Butyl 1-iminothiomorpholine-4-carboxylate 1-oxide, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg, 5g.
Tert-butyl 1-imino-1-oxo-1,4-thiazinane-4-carboxylate (CAS 1609964-38-6) is a chemical compound with the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. IUPAC name: tert-butyl 1-imino-1-oxo-1,4-thiazinane-4-carboxylate. InChIKey: YCOLCFXJGBOPGF-UHFFFAOYSA-N.
| Molecular formula | C9H18N2O3S |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | tert-butyl 1-imino-1-oxo-1,4-thiazinane-4-carboxylate |
| InChIKey | YCOLCFXJGBOPGF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCS(=N)(=O)CC1 |
Computed by PubChem (NCBI)