Products 2241129-90-6

CAS 2241129-90-6 is the registry number for tert-Butyl 3-(imino(methyl)oxo-λâ¶-sulfanyl)azetidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-(methylsulfonimidoyl)azetidine-1-carboxylate (CAS 2241129-90-6) is a chemical compound with the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. IUPAC name: tert-butyl 3-(methylsulfonimidoyl)azetidine-1-carboxylate. InChIKey: XBAGTXLLGNUZGR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18N2O3S
Molecular weight234.32 g/mol
IUPAC nametert-butyl 3-(methylsulfonimidoyl)azetidine-1-carboxylate
InChIKeyXBAGTXLLGNUZGR-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC(C1)S(=N)(=O)C

Computed by PubChem (NCBI)