Products 1610093-13-4
CAS 1610093-13-4 is the registry number for rac-(1R,3S,5S)-3-(Pyridin-3-yl)-8-azabicyclo(3.2.1)octan-3-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S,5R)-3-pyridin-3-yl-8-azabicyclo[3.2.1]octan-3-ol (CAS 1610093-13-4) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: (1S,5R)-3-pyridin-3-yl-8-azabicyclo[3.2.1]octan-3-ol. InChIKey: PXQGMKCOEWJKCZ-FOSCPWQOSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | (1S,5R)-3-pyridin-3-yl-8-azabicyclo[3.2.1]octan-3-ol |
| InChIKey | PXQGMKCOEWJKCZ-FOSCPWQOSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2)(C3=CN=CC=C3)O |
Computed by PubChem (NCBI)