Products 161070-01-5
CAS 161070-01-5 appears in our catalog under these names: Propofol Impurity 7, Propofol Impurity 30, Propofol Impurity 27, 4-isopropoxy-3-isopropylbenzoic acid, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g.
3-propan-2-yl-4-propan-2-yloxybenzoic acid (CAS 161070-01-5) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 3-propan-2-yl-4-propan-2-yloxybenzoic acid. InChIKey: VALRQCBRRJJHGY-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 3-propan-2-yl-4-propan-2-yloxybenzoic acid |
| InChIKey | VALRQCBRRJJHGY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)C(=O)O)OC(C)C |
Computed by PubChem (NCBI)
Synonyms:
4-Isopropoxy-3-isopropylbenzoic acid