Products 161121-03-5
CAS 161121-03-5 appears in our catalog under these names: (R)-1-(3,4-Dimethoxyphenyl)propan-2-ol, 99%, 99%, (R)-1-(3,4-DIMETHOXYPHENYL)PROPAN-2-OL. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
(2R)-1-(3,4-dimethoxyphenyl)propan-2-ol (CAS 161121-03-5) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: (2R)-1-(3,4-dimethoxyphenyl)propan-2-ol. InChIKey: KWJDGWGMDAQESJ-MRVPVSSYSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | (2R)-1-(3,4-dimethoxyphenyl)propan-2-ol |
| InChIKey | KWJDGWGMDAQESJ-MRVPVSSYSA-N |
| SMILES | C[C@H](CC1=CC(=C(C=C1)OC)OC)O |
Computed by PubChem (NCBI)