CAS 1612-76-6 appears in our catalog under these names: 2–Amino–5–phenyl–1,3,4–oxadiazole, 2-Amino-5-phenyl-1,3,4-oxadiazole, >97.0%(GC)(T), 5-Phenyl-1,3,4-oxadiazol-2-amine 98%, 2-AMINO-5-PHENYL-1,3,4-OXADIAZOLE, 97%, 1,3,4-Oxadiazol-2-amine, 5-phenyl-, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 250mg.
5-phenyl-1,3,4-oxadiazol-2-amine (CAS 1612-76-6) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 5-phenyl-1,3,4-oxadiazol-2-amine. InChIKey: CQSFYCBGVMWPCM-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 5-phenyl-1,3,4-oxadiazol-2-amine |
| InChIKey | CQSFYCBGVMWPCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)N |
Computed by PubChem (NCBI)