CAS 1612174-07-8 is the registry number for tert-Butyl (3S,4R)-3-fluoro-4-methoxypiperidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3S,4R)-3-fluoro-4-methoxypiperidine-1-carboxylate (CAS 1612174-07-8) is a chemical compound with the molecular formula C11H20FNO3 and a molecular weight of 233.28 g/mol. IUPAC name: tert-butyl (3S,4R)-3-fluoro-4-methoxypiperidine-1-carboxylate. InChIKey: OSUMJNNYQSUXFZ-DTWKUNHWSA-N.
| Molecular formula | C11H20FNO3 |
|---|---|
| Molecular weight | 233.28 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3-fluoro-4-methoxypiperidine-1-carboxylate |
| InChIKey | OSUMJNNYQSUXFZ-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)F)OC |
Computed by PubChem (NCBI)