CAS 1612244-15-1 is the registry number for 3-Chloro-2-fluoro-1,1'-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g.
1-chloro-2-fluoro-3-phenylbenzene (CAS 1612244-15-1) is a chemical compound with the molecular formula C12H8ClF and a molecular weight of 206.64 g/mol. IUPAC name: 1-chloro-2-fluoro-3-phenylbenzene. InChIKey: RCZUIPQKHQYHMD-UHFFFAOYSA-N.
| Molecular formula | C12H8ClF |
|---|---|
| Molecular weight | 206.64 g/mol |
| IUPAC name | 1-chloro-2-fluoro-3-phenylbenzene |
| InChIKey | RCZUIPQKHQYHMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=CC=C2)Cl)F |
Computed by PubChem (NCBI)