Products 72093-46-0

CAS 72093-46-0 is the registry number for 4′-Chloro-3-fluoro-1,1′-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-chloro-4-(3-fluorophenyl)benzene (CAS 72093-46-0) is a chemical compound with the molecular formula C12H8ClF and a molecular weight of 206.64 g/mol. IUPAC name: 1-chloro-4-(3-fluorophenyl)benzene. InChIKey: FYHDSEUFZNDKEM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8ClF
Molecular weight206.64 g/mol
IUPAC name1-chloro-4-(3-fluorophenyl)benzene
InChIKeyFYHDSEUFZNDKEM-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)F)C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)