CAS 72093-46-0 is the registry number for 4′-Chloro-3-fluoro-1,1′-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
1-chloro-4-(3-fluorophenyl)benzene (CAS 72093-46-0) is a chemical compound with the molecular formula C12H8ClF and a molecular weight of 206.64 g/mol. IUPAC name: 1-chloro-4-(3-fluorophenyl)benzene. InChIKey: FYHDSEUFZNDKEM-UHFFFAOYSA-N.
| Molecular formula | C12H8ClF |
|---|---|
| Molecular weight | 206.64 g/mol |
| IUPAC name | 1-chloro-4-(3-fluorophenyl)benzene |
| InChIKey | FYHDSEUFZNDKEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)