CAS 161262-45-9 appears in our catalog under these names: Amotosalen hydrochloride, 3-((2-Aminoethoxy)methyl)-2,5,9-trimethyl-7H-furo[3,2-g]chromen-7-one hydrochloride, 98.99%, 98.99%, Amotosalen (hydrochloride), 99.86%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mM (in 1ml dmso), 10mg, 100 mg, 5 mg, 10 mg, 25 mg.
3-(2-aminoethoxymethyl)-2,5,9-trimethylfuro[3,2-g]chromen-7-one;hydrochloride (CAS 161262-45-9) is a chemical compound with the molecular formula C17H20ClNO4 and a molecular weight of 337.8 g/mol. IUPAC name: 3-(2-aminoethoxymethyl)-2,5,9-trimethylfuro[3,2-g]chromen-7-one;hydrochloride. InChIKey: MHLAMQBABOJZQW-UHFFFAOYSA-N.
| Molecular formula | C17H20ClNO4 |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | 3-(2-aminoethoxymethyl)-2,5,9-trimethylfuro[3,2-g]chromen-7-one;hydrochloride |
| InChIKey | MHLAMQBABOJZQW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C(C3=C(C=C12)C(=C(O3)C)COCCN)C.Cl |
Computed by PubChem (NCBI)