Products 1612768-97-4
CAS 1612768-97-4 is the registry number for trans-1-benzyl-4-methyl-piperidin-3-amine, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(3R,4S)-1-benzyl-4-methylpiperidin-3-amine (CAS 1612768-97-4) is a chemical compound with the molecular formula C13H20N2 and a molecular weight of 204.31 g/mol. IUPAC name: (3R,4S)-1-benzyl-4-methylpiperidin-3-amine. InChIKey: UMKXOVBYIBQJBM-AAEUAGOBSA-N.
| Molecular formula | C13H20N2 |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-4-methylpiperidin-3-amine |
| InChIKey | UMKXOVBYIBQJBM-AAEUAGOBSA-N |
| SMILES | C[C@H]1CCN(C[C@@H]1N)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)