CAS 2026634-40-0 is the registry number for Tofacitinib Impurity 64. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R)-1-benzyl-4-methylpiperidin-3-amine (CAS 2026634-40-0) is a chemical compound with the molecular formula C13H20N2 and a molecular weight of 204.31 g/mol. IUPAC name: (3R,4R)-1-benzyl-4-methylpiperidin-3-amine. InChIKey: UMKXOVBYIBQJBM-YPMHNXCESA-N.
| Molecular formula | C13H20N2 |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | (3R,4R)-1-benzyl-4-methylpiperidin-3-amine |
| InChIKey | UMKXOVBYIBQJBM-YPMHNXCESA-N |
| SMILES | C[C@@H]1CCN(C[C@@H]1N)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)