Products 1613134-39-6

CAS 1613134-39-6 is the registry number for Methyl 1-(2-aminoethyl)-1H-1,2,3-triazole-4-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 1-(2-aminoethyl)triazole-4-carboxylate;hydrochloride (CAS 1613134-39-6) is a chemical compound with the molecular formula C6H11ClN4O2 and a molecular weight of 206.63 g/mol. IUPAC name: methyl 1-(2-aminoethyl)triazole-4-carboxylate;hydrochloride. InChIKey: YBIZLUMVLRTTRQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClN4O2
Molecular weight206.63 g/mol
IUPAC namemethyl 1-(2-aminoethyl)triazole-4-carboxylate;hydrochloride
InChIKeyYBIZLUMVLRTTRQ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CN(N=N1)CCN.Cl

Computed by PubChem (NCBI)