Products 161314-70-1
CAS 161314-70-1 is the registry number for CGS 27023A (free base). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide (CAS 161314-70-1) is a chemical compound with the molecular formula C18H23N3O5S and a molecular weight of 393.5 g/mol. IUPAC name: (2R)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide. InChIKey: BSIZUMJRKYHEBR-QGZVFWFLSA-N.
| Molecular formula | C18H23N3O5S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | (2R)-N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanamide |
| InChIKey | BSIZUMJRKYHEBR-QGZVFWFLSA-N |
| SMILES | CC(C)[C@H](C(=O)NO)N(CC1=CN=CC=C1)S(=O)(=O)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)