CAS 1613222-54-0 appears in our catalog under these names: 2-(Bis(4-fluorophenyl)methylsulfinyl)-N-methylacetamide, N-methyl-4,4-difluoro Modafinil. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 5 mg, 1 mg.
2-[bis(4-fluorophenyl)methylsulfinyl]-N-methylacetamide (CAS 1613222-54-0) is a chemical compound with the molecular formula C16H15F2NO2S and a molecular weight of 323.4 g/mol. IUPAC name: 2-[bis(4-fluorophenyl)methylsulfinyl]-N-methylacetamide. InChIKey: MQZWTCIUDSDFCQ-UHFFFAOYSA-N.
| Molecular formula | C16H15F2NO2S |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 2-[bis(4-fluorophenyl)methylsulfinyl]-N-methylacetamide |
| InChIKey | MQZWTCIUDSDFCQ-UHFFFAOYSA-N |
| SMILES | CNC(=O)CS(=O)C(C1=CC=C(C=C1)F)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)