CAS 3082852-63-6 is the registry number for 3βHSD1-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(3,5-difluoro-4-hydroxy-2-methylphenyl)-6,6-dimethyl-4,5-dihydro-1,3-benzothiazol-7-one (CAS 3082852-63-6) is a chemical compound with the molecular formula C16H15F2NO2S and a molecular weight of 323.4 g/mol. IUPAC name: 2-(3,5-difluoro-4-hydroxy-2-methylphenyl)-6,6-dimethyl-4,5-dihydro-1,3-benzothiazol-7-one. InChIKey: WINLCXKYFLCMFW-UHFFFAOYSA-N.
| Molecular formula | C16H15F2NO2S |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 2-(3,5-difluoro-4-hydroxy-2-methylphenyl)-6,6-dimethyl-4,5-dihydro-1,3-benzothiazol-7-one |
| InChIKey | WINLCXKYFLCMFW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1C2=NC3=C(S2)C(=O)C(CC3)(C)C)F)O)F |
Computed by PubChem (NCBI)