CAS 1613413-41-4 is the registry number for [4-Chloro-3-(2,2,2-trifluoroethoxy)phenyl]methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]methanol (CAS 1613413-41-4) is a chemical compound with the molecular formula C9H8ClF3O2 and a molecular weight of 240.60 g/mol. IUPAC name: [4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]methanol. InChIKey: YYJHPOOMOYDAKX-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3O2 |
|---|---|
| Molecular weight | 240.60 g/mol |
| IUPAC name | [4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]methanol |
| InChIKey | YYJHPOOMOYDAKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CO)OCC(F)(F)F)Cl |
Computed by PubChem (NCBI)