Products 2764731-42-0
CAS 2764731-42-0 is the registry number for 4-Chloro-2-(methoxymethoxy)-1-(trifluoromethyl)benzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
4-chloro-2-(methoxymethoxy)-1-(trifluoromethyl)benzene (CAS 2764731-42-0) is a chemical compound with the molecular formula C9H8ClF3O2 and a molecular weight of 240.60 g/mol. IUPAC name: 4-chloro-2-(methoxymethoxy)-1-(trifluoromethyl)benzene. InChIKey: KXPIJZBAPUSHEJ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3O2 |
|---|---|
| Molecular weight | 240.60 g/mol |
| IUPAC name | 4-chloro-2-(methoxymethoxy)-1-(trifluoromethyl)benzene |
| InChIKey | KXPIJZBAPUSHEJ-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C=CC(=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)