CAS 1613458-70-0 appears in our catalog under these names: GSK–2793660, GSK-2793660, GSK-2793660 (free base). Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
4-amino-N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxohex-4-en-3-yl]oxane-4-carboxamide (CAS 1613458-70-0) is a chemical compound with the molecular formula C20H27N3O3 and a molecular weight of 357.4 g/mol. IUPAC name: 4-amino-N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxohex-4-en-3-yl]oxane-4-carboxamide. InChIKey: IVMRHVTWOHFAKG-WAVCKPEOSA-N.
| Molecular formula | C20H27N3O3 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 4-amino-N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxohex-4-en-3-yl]oxane-4-carboxamide |
| InChIKey | IVMRHVTWOHFAKG-WAVCKPEOSA-N |
| SMILES | CC[C@@H](/C=C/C(=O)N1CCC2=CC=CC=C21)NC(=O)C3(CCOCC3)N |
Computed by PubChem (NCBI)