CAS 2504100-70-1 is the registry number for MDMB-4en-PINACA. Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
Methyl (2S)-3,3-dimethyl-2-[(1-pent-4-enylindazole-3-carbonyl)amino]butanoate (CAS 2504100-70-1) is a chemical compound with the molecular formula C20H27N3O3 and a molecular weight of 357.4 g/mol. IUPAC name: methyl (2S)-3,3-dimethyl-2-[(1-pent-4-enylindazole-3-carbonyl)amino]butanoate. InChIKey: LWOCBHBFWNGPGM-QGZVFWFLSA-N.
| Molecular formula | C20H27N3O3 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | methyl (2S)-3,3-dimethyl-2-[(1-pent-4-enylindazole-3-carbonyl)amino]butanoate |
| InChIKey | LWOCBHBFWNGPGM-QGZVFWFLSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)OC)NC(=O)C1=NN(C2=CC=CC=C21)CCCC=C |
Computed by PubChem (NCBI)