Products 16141-90-5
CAS 16141-90-5 appears in our catalog under these names: 1-(4-Fluorophenyl)-Piperazine Hydrochloride (1:1), 1-(4-FLUOROPHENYL)PIPERAZINE HYDROCHLORIDE, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 250mg, 500mg, 1000mg, 5g, 25g, 100g.
1-(4-fluorophenyl)piperazine;hydrochloride (CAS 16141-90-5) is a chemical compound with the molecular formula C10H14ClFN2 and a molecular weight of 216.68 g/mol. IUPAC name: 1-(4-fluorophenyl)piperazine;hydrochloride. InChIKey: OIKQTWPVQQAGJG-UHFFFAOYSA-N.
| Molecular formula | C10H14ClFN2 |
|---|---|
| Molecular weight | 216.68 g/mol |
| IUPAC name | 1-(4-fluorophenyl)piperazine;hydrochloride |
| InChIKey | OIKQTWPVQQAGJG-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)