CAS 2306270-51-7 is the registry number for 6-Fluoro-2,3,4,5-tetrahydro-1h-1-benzazepin-9-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-9-amine;hydrochloride (CAS 2306270-51-7) is a chemical compound with the molecular formula C10H14ClFN2 and a molecular weight of 216.68 g/mol. IUPAC name: 6-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-9-amine;hydrochloride. InChIKey: FRXOIRMNOXDLAX-UHFFFAOYSA-N.
| Molecular formula | C10H14ClFN2 |
|---|---|
| Molecular weight | 216.68 g/mol |
| IUPAC name | 6-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-9-amine;hydrochloride |
| InChIKey | FRXOIRMNOXDLAX-UHFFFAOYSA-N |
| SMILES | C1CCNC2=C(C=CC(=C2C1)F)N.Cl |
Computed by PubChem (NCBI)