CAS 161468-95-7 is the registry number for 1-(2-Chlorobenzyl)-1,3-dihydro-2h-benzimidazol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[(2-chlorophenyl)methyl]-1H-benzimidazol-2-one (CAS 161468-95-7) is a chemical compound with the molecular formula C14H11ClN2O and a molecular weight of 258.70 g/mol. IUPAC name: 3-[(2-chlorophenyl)methyl]-1H-benzimidazol-2-one. InChIKey: OFDCITQYEIWQPO-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 3-[(2-chlorophenyl)methyl]-1H-benzimidazol-2-one |
| InChIKey | OFDCITQYEIWQPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C3=CC=CC=C3NC2=O)Cl |
Computed by PubChem (NCBI)