CAS 235742-72-0 is the registry number for (R)-2-(4-Chloropyridin-2-yl)-4-phenyl-4,5-dihydrooxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-2-(4-chloro-2-pyridinyl)-4-phenyl-4,5-dihydro-1,3-oxazole (CAS 235742-72-0) is a chemical compound with the molecular formula C14H11ClN2O and a molecular weight of 258.70 g/mol. IUPAC name: (4R)-2-(4-chloro-2-pyridinyl)-4-phenyl-4,5-dihydro-1,3-oxazole. InChIKey: DRIDYVJXRZZAIR-ZDUSSCGKSA-N.
| Molecular formula | C14H11ClN2O |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | (4R)-2-(4-chloro-2-pyridinyl)-4-phenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | DRIDYVJXRZZAIR-ZDUSSCGKSA-N |
| SMILES | C1[C@H](N=C(O1)C2=NC=CC(=C2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)