Products 16151-14-7
CAS 16151-14-7 appears in our catalog under these names: 3-Acetyl-4,6-dimethylpyridin-2(1H)-one, 97%, 3-Acetyl-4,6-dimethyl-1,2-dihydropyridin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 2,5g.
3-acetyl-4,6-dimethyl-1H-pyridin-2-one (CAS 16151-14-7) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 3-acetyl-4,6-dimethyl-1H-pyridin-2-one. InChIKey: FPZYYMHZCULYSO-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 3-acetyl-4,6-dimethyl-1H-pyridin-2-one |
| InChIKey | FPZYYMHZCULYSO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)C(=O)C)C |
Computed by PubChem (NCBI)