CAS 16152-10-6 appears in our catalog under these names: Poly(9,9-di-(2-ethylhexyl)-fluorenyl-2,7-diyl) end capped with 2,5-diphenyl-1,2,4-oxadiazole, 3,5–Diphenyl–4–(1–naphthyl)–1H–1,2,4–triazole, 4-(1-Naphthyl)-3,5-diphenyl-1,2,4-triazole, >98.0%(GC), NTAZ 98%, 4-(1-Naphthyl)-3,5-diphenyl-1,2,4-triazol, 98%, 98%. Offered by: Lumtec, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: On request, 1g, 250mg, 200mg, 100mg, 5g.
4-naphthalen-1-yl-3,5-diphenyl-1,2,4-triazole (CAS 16152-10-6) is a chemical compound with the molecular formula C24H17N3 and a molecular weight of 347.4 g/mol. IUPAC name: 4-naphthalen-1-yl-3,5-diphenyl-1,2,4-triazole. InChIKey: AOQKGYRILLEVJV-UHFFFAOYSA-N.
| Molecular formula | C24H17N3 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 4-naphthalen-1-yl-3,5-diphenyl-1,2,4-triazole |
| InChIKey | AOQKGYRILLEVJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(N2C3=CC=CC4=CC=CC=C43)C5=CC=CC=C5 |
Computed by PubChem (NCBI)