CAS 84833-17-0 is the registry number for 4-(Naphthalen-2-yl)-3,5-diphenyl-4H-1,2,4-triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-naphthalen-2-yl-3,5-diphenyl-1,2,4-triazole (CAS 84833-17-0) is a chemical compound with the molecular formula C24H17N3 and a molecular weight of 347.4 g/mol. IUPAC name: 4-naphthalen-2-yl-3,5-diphenyl-1,2,4-triazole. InChIKey: DXZRAGOWMLSWEJ-UHFFFAOYSA-N.
| Molecular formula | C24H17N3 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 4-naphthalen-2-yl-3,5-diphenyl-1,2,4-triazole |
| InChIKey | DXZRAGOWMLSWEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(N2C3=CC4=CC=CC=C4C=C3)C5=CC=CC=C5 |
Computed by PubChem (NCBI)