Products 16156-93-7

CAS 16156-93-7 is the registry number for Metronidazole Impurity 14. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-[2-(2-chloroethoxy)ethyl]-2-methyl-5-nitroimidazole (CAS 16156-93-7) is a chemical compound with the molecular formula C8H12ClN3O3 and a molecular weight of 233.65 g/mol. IUPAC name: 1-[2-(2-chloroethoxy)ethyl]-2-methyl-5-nitroimidazole. InChIKey: YNVBDRPGHSFRGV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12ClN3O3
Molecular weight233.65 g/mol
IUPAC name1-[2-(2-chloroethoxy)ethyl]-2-methyl-5-nitroimidazole
InChIKeyYNVBDRPGHSFRGV-UHFFFAOYSA-N
SMILESCC1=NC=C(N1CCOCCCl)[N+](=O)[O-]

Computed by PubChem (NCBI)