CAS 16156-93-7 is the registry number for Metronidazole Impurity 14. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1-[2-(2-chloroethoxy)ethyl]-2-methyl-5-nitroimidazole (CAS 16156-93-7) is a chemical compound with the molecular formula C8H12ClN3O3 and a molecular weight of 233.65 g/mol. IUPAC name: 1-[2-(2-chloroethoxy)ethyl]-2-methyl-5-nitroimidazole. InChIKey: YNVBDRPGHSFRGV-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN3O3 |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 1-[2-(2-chloroethoxy)ethyl]-2-methyl-5-nitroimidazole |
| InChIKey | YNVBDRPGHSFRGV-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CCOCCCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)