CAS 1824293-17-5 appears in our catalog under these names: 2-(3-(Dimethylamino)-2-oxopyrazin-1(2H)-yl)acetic acid hcl, 95%, 2-(3-(Dimethylamino)-2-Oxopyrazin-1(2H)-Yl)Acetic Acid Hydrochloride, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-[3-(dimethylamino)-2-oxopyrazin-1-yl]acetic acid;hydrochloride (CAS 1824293-17-5) is a chemical compound with the molecular formula C8H12ClN3O3 and a molecular weight of 233.65 g/mol. IUPAC name: 2-[3-(dimethylamino)-2-oxopyrazin-1-yl]acetic acid;hydrochloride. InChIKey: YISFTPRYGQSAEE-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN3O3 |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 2-[3-(dimethylamino)-2-oxopyrazin-1-yl]acetic acid;hydrochloride |
| InChIKey | YISFTPRYGQSAEE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=CN(C1=O)CC(=O)O.Cl |
Computed by PubChem (NCBI)