CAS 1616244-35-9 is the registry number for 2-Chloro-3-bromo-5,6-difluoroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-bromo-2-chloro-5,6-difluoroaniline (CAS 1616244-35-9) is a chemical compound with the molecular formula C6H3BrClF2N and a molecular weight of 242.45 g/mol. IUPAC name: 3-bromo-2-chloro-5,6-difluoroaniline. InChIKey: VDGVVKCMSCFVSM-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClF2N |
|---|---|
| Molecular weight | 242.45 g/mol |
| IUPAC name | 3-bromo-2-chloro-5,6-difluoroaniline |
| InChIKey | VDGVVKCMSCFVSM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Cl)N)F)F |
Computed by PubChem (NCBI)