Products 1895912-80-7
CAS 1895912-80-7 is the registry number for 4-Bromo-6-chloro-2,3-difluoroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-6-chloro-2,3-difluoroaniline (CAS 1895912-80-7) is a chemical compound with the molecular formula C6H3BrClF2N and a molecular weight of 242.45 g/mol. IUPAC name: 4-bromo-6-chloro-2,3-difluoroaniline. InChIKey: KOYRUTVRISCZSB-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClF2N |
|---|---|
| Molecular weight | 242.45 g/mol |
| IUPAC name | 4-bromo-6-chloro-2,3-difluoroaniline |
| InChIKey | KOYRUTVRISCZSB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)F)N)Cl |
Computed by PubChem (NCBI)