CAS 1616693-62-9 is the registry number for N–(5–Chloro–pyridin–2–yl)–5–hydroxy–2–nitro–benzamide. Offered by: GLPBio. Available pack sizes: 200mg.
N-(5-chloro-2-pyridinyl)-5-hydroxy-2-nitrobenzamide (CAS 1616693-62-9) is a chemical compound with the molecular formula C12H8ClN3O4 and a molecular weight of 293.66 g/mol. IUPAC name: N-(5-chloro-2-pyridinyl)-5-hydroxy-2-nitrobenzamide. InChIKey: FMWBQLYSTIGOHS-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3O4 |
|---|---|
| Molecular weight | 293.66 g/mol |
| IUPAC name | N-(5-chloro-2-pyridinyl)-5-hydroxy-2-nitrobenzamide |
| InChIKey | FMWBQLYSTIGOHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C(=O)NC2=NC=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)