CAS 2832026-04-5 is the registry number for 3-Chloro-6-(2,6-dioxopiperidin-3-yl)-5H-pyrrolo[3,4-b]pyridine-5,7(6H)-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-6-(2,6-dioxopiperidin-3-yl)pyrrolo[3,4-b]pyridine-5,7-dione (CAS 2832026-04-5) is a chemical compound with the molecular formula C12H8ClN3O4 and a molecular weight of 293.66 g/mol. IUPAC name: 3-chloro-6-(2,6-dioxopiperidin-3-yl)pyrrolo[3,4-b]pyridine-5,7-dione. InChIKey: ZRGGGCXIAGZPHT-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3O4 |
|---|---|
| Molecular weight | 293.66 g/mol |
| IUPAC name | 3-chloro-6-(2,6-dioxopiperidin-3-yl)pyrrolo[3,4-b]pyridine-5,7-dione |
| InChIKey | ZRGGGCXIAGZPHT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)N=CC(=C3)Cl |
Computed by PubChem (NCBI)