Products 1616709-11-5
CAS 1616709-11-5 is the registry number for 2-(Chloromethyl)-7-(methoxymethyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(chloromethyl)-7-(methoxymethyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-amine (CAS 1616709-11-5) is a chemical compound with the molecular formula C12H12ClN5O and a molecular weight of 277.71 g/mol. IUPAC name: 2-(chloromethyl)-7-(methoxymethyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-amine. InChIKey: YZGRUUWJCIUCAO-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN5O |
|---|---|
| Molecular weight | 277.71 g/mol |
| IUPAC name | 2-(chloromethyl)-7-(methoxymethyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-amine |
| InChIKey | YZGRUUWJCIUCAO-UHFFFAOYSA-N |
| SMILES | COCC1=C2C(=CC=C1)C3=NC(=NN3C(=N2)N)CCl |
Computed by PubChem (NCBI)