CAS 20755-15-1 appears in our catalog under these names: 2-Amino-7-benzyl-1,7-dihydro-6H-purin-6-one hydrochloride, 98%, 2-Amino-7-benzyl-1,7-dihydro-6H-purin-6-one hydrochloride, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
2-amino-7-benzyl-1H-purin-6-one;hydrochloride (CAS 20755-15-1) is a chemical compound with the molecular formula C12H12ClN5O and a molecular weight of 277.71 g/mol. IUPAC name: 2-amino-7-benzyl-1H-purin-6-one;hydrochloride. InChIKey: NFEPYUIHMLLXRO-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN5O |
|---|---|
| Molecular weight | 277.71 g/mol |
| IUPAC name | 2-amino-7-benzyl-1H-purin-6-one;hydrochloride |
| InChIKey | NFEPYUIHMLLXRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC3=C2C(=O)NC(=N3)N.Cl |
Computed by PubChem (NCBI)