Products 161710-10-7
CAS 161710-10-7 appears in our catalog under these names: Z–Ile–Leu–aldehyde, Z-Ile-Leu-aldehyde, Z-Ile-Leu-aldehyde 97%, Z-Ile-Leu-aldehyde, 97.28%, 97.28%, Z-Ile-Leu-aldehyde, 98.0%. Offered by: GLPBio, Creative Peptides, TargetMol, Biosynth, Ambeed. Available pack sizes: 10mg, on request, 2mg, 5mg, 10mM (in 1ml dmso), 50mg, 25mg, 1mg.
Benzyl N-[(2S,3S)-3-methyl-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]carbamate (CAS 161710-10-7) is a chemical compound with the molecular formula C20H30N2O4 and a molecular weight of 362.5 g/mol. IUPAC name: benzyl N-[(2S,3S)-3-methyl-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]carbamate. InChIKey: WJQLUFQGNVGLKR-SZMVWBNQSA-N.
| Molecular formula | C20H30N2O4 |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | benzyl N-[(2S,3S)-3-methyl-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]carbamate |
| InChIKey | WJQLUFQGNVGLKR-SZMVWBNQSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)N[C@@H](CC(C)C)C=O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)