Products 2749435-22-9

CAS 2749435-22-9 is the registry number for 4–acetoxy DiPT (acetate). Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 5mg.

Structural formula: {0} (CAS {1})

Acetic acid;[3-[2-[di(propan-2-yl)amino]ethyl]-1H-indol-4-yl] acetate (CAS 2749435-22-9) is a chemical compound with the molecular formula C20H30N2O4 and a molecular weight of 362.5 g/mol. IUPAC name: acetic acid;[3-[2-[di(propan-2-yl)amino]ethyl]-1H-indol-4-yl] acetate. InChIKey: VCOMLUJEOMXDIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H30N2O4
Molecular weight362.5 g/mol
IUPAC nameacetic acid;[3-[2-[di(propan-2-yl)amino]ethyl]-1H-indol-4-yl] acetate
InChIKeyVCOMLUJEOMXDIQ-UHFFFAOYSA-N
SMILESCC(C)N(CCC1=CNC2=C1C(=CC=C2)OC(=O)C)C(C)C.CC(=O)O

Computed by PubChem (NCBI)