Products 1617498-09-5
CAS 1617498-09-5 appears in our catalog under these names: 2-Bromo-5-fluorophenyl tert-butyl carbonate, 95%, 2-Bromo-5-Fluorophenyl Tert-Butyl Carbonate, >95%. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm. Available pack sizes: 5g, 25g, 100g, 1g, 10g.
(2-bromo-5-fluorophenyl) tert-butyl carbonate (CAS 1617498-09-5) is a chemical compound with the molecular formula C11H12BrFO3 and a molecular weight of 291.11 g/mol. IUPAC name: (2-bromo-5-fluorophenyl) tert-butyl carbonate. InChIKey: LVGBFRPKBOTJHI-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO3 |
|---|---|
| Molecular weight | 291.11 g/mol |
| IUPAC name | (2-bromo-5-fluorophenyl) tert-butyl carbonate |
| InChIKey | LVGBFRPKBOTJHI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=C(C=CC(=C1)F)Br |
Computed by PubChem (NCBI)