CAS 1617514-17-6 is the registry number for 4(3H)-Quinazolinone, 2-(1-aminopropyl)-5-fluoro-3-phenyl-. Offered by: Chemat. Available pack sizes: 1g.
2-(1-aminopropyl)-5-fluoro-3-phenylquinazolin-4-one (CAS 1617514-17-6) is a chemical compound with the molecular formula C17H16FN3O and a molecular weight of 297.33 g/mol. IUPAC name: 2-(1-aminopropyl)-5-fluoro-3-phenylquinazolin-4-one. InChIKey: BNMGOWXQUZHWIO-UHFFFAOYSA-N.
| Molecular formula | C17H16FN3O |
|---|---|
| Molecular weight | 297.33 g/mol |
| IUPAC name | 2-(1-aminopropyl)-5-fluoro-3-phenylquinazolin-4-one |
| InChIKey | BNMGOWXQUZHWIO-UHFFFAOYSA-N |
| SMILES | CCC(C1=NC2=C(C(=CC=C2)F)C(=O)N1C3=CC=CC=C3)N |
Computed by PubChem (NCBI)