CAS 2044710-26-9 appears in our catalog under these names: Idelalisib Impurity 8, Idelalisib Impurity 10. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[(1R)-1-aminopropyl]-5-fluoro-3-phenylquinazolin-4-one (CAS 2044710-26-9) is a chemical compound with the molecular formula C17H16FN3O and a molecular weight of 297.33 g/mol. IUPAC name: 2-[(1R)-1-aminopropyl]-5-fluoro-3-phenylquinazolin-4-one. InChIKey: BNMGOWXQUZHWIO-CYBMUJFWSA-N.
| Molecular formula | C17H16FN3O |
|---|---|
| Molecular weight | 297.33 g/mol |
| IUPAC name | 2-[(1R)-1-aminopropyl]-5-fluoro-3-phenylquinazolin-4-one |
| InChIKey | BNMGOWXQUZHWIO-CYBMUJFWSA-N |
| SMILES | CC[C@H](C1=NC2=C(C(=CC=C2)F)C(=O)N1C3=CC=CC=C3)N |
Computed by PubChem (NCBI)