Products 161809-64-9
CAS 161809-64-9 is the registry number for 3-(4-Bromophenyl)-1,1,1-trifluoro-2-propanone, 95%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
3-(4-bromophenyl)-1,1,1-trifluoropropan-2-one (CAS 161809-64-9) is a chemical compound with the molecular formula C9H6BrF3O and a molecular weight of 267.04 g/mol. IUPAC name: 3-(4-bromophenyl)-1,1,1-trifluoropropan-2-one. InChIKey: NCMUNOOVWJTDOO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O |
|---|---|
| Molecular weight | 267.04 g/mol |
| IUPAC name | 3-(4-bromophenyl)-1,1,1-trifluoropropan-2-one |
| InChIKey | NCMUNOOVWJTDOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)